C20H25NO6 — CID 67677147
3-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]propyl 2-phenoxyacetate (PubChem CID 67677147) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is 3-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]propyl 2-phenoxyacetate.
| Compound Name | 3-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]propyl 2-phenoxyacetate |
|---|---|
| PubChem CID | 67677147 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 3-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]propyl 2-phenoxyacetate |
| SMILES | O=C(COc1ccccc1)OCCCNCC(O)COc1ccc(O)cc1 |
| InChI | InChI=1S/C20H25NO6/c22-16-7-9-19(10-8-16)26-14-17(23)13-21-11-4-12-25-20(24)15-27-18-5-2-1-3-6-18/h1-3,5-10,17,21-23H,4,11-15H2 |
| InChIKey | SWCMQOMBDBRDFA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|