C21H28N2O5 — CID 15174918
N-ethyl-2-[4-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]acetamide (PubChem CID 15174918) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is N-ethyl-2-[4-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]acetamide.
| Compound Name | N-ethyl-2-[4-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]acetamide |
|---|---|
| PubChem CID | 15174918 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-ethyl-2-[4-[2-[(2-hydroxy-3-phenoxypropyl)amino]ethoxy]phenoxy]acetamide |
| SMILES | CCNC(=O)COc1ccc(OCCNCC(O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C21H28N2O5/c1-2-23-21(25)16-28-20-10-8-19(9-11-20)26-13-12-22-14-17(24)15-27-18-6-4-3-5-7-18/h3-11,17,22,24H,2,12-16H2,1H3,(H,23,25) |
| InChIKey | QNXKAIHDIFRTMB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|