C21H23NO6 — CID 67693125
2-acetyl-5-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethoxy]-1-benzofuran-3-one (PubChem CID 67693125) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-acetyl-5-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethoxy]-1-benzofuran-3-one.
| Compound Name | 2-acetyl-5-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethoxy]-1-benzofuran-3-one |
|---|---|
| PubChem CID | 67693125 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2-acetyl-5-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethoxy]-1-benzofuran-3-one |
| SMILES | CC(=O)C1Oc2ccc(OCCNC[C@H](O)COc3ccccc3)cc2C1=O |
| InChI | InChI=1S/C21H23NO6/c1-14(23)21-20(25)18-11-17(7-8-19(18)28-21)26-10-9-22-12-15(24)13-27-16-5-3-2-4-6-16/h2-8,11,15,21-22,24H,9-10,12-13H2,1H3/t15-,21?/m0/s1 |
| InChIKey | FVXXUTZKZZVVFG-ZDGMYTEDSA-N |
| XLogP | 1.63 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|