C21H23NO6 — CID 67665235
methyl 5-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethoxy]-1-benzofuran-2-carboxylate (PubChem CID 67665235) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is methyl 5-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethoxy]-1-benzofuran-2-carboxylate.
| Compound Name | methyl 5-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethoxy]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 67665235 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | methyl 5-[2-[[(2S)-2-hydroxy-3-phenoxypropyl]amino]ethoxy]-1-benzofuran-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(OCCNC[C@H](O)COc3ccccc3)ccc2o1 |
| InChI | InChI=1S/C21H23NO6/c1-25-21(24)20-12-15-11-18(7-8-19(15)28-20)26-10-9-22-13-16(23)14-27-17-5-3-2-4-6-17/h2-8,11-12,16,22-23H,9-10,13-14H2,1H3/t16-/m0/s1 |
| InChIKey | WPZIILXYSJBOQY-INIZCTEOSA-N |
| XLogP | 2.63 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|