C20H21NO4 — CID 110177515
1-(1-benzofuran-2-yl)-3-[(2-hydroxy-3-phenoxypropyl)amino]propan-1-one (PubChem CID 110177515) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-3-[(2-hydroxy-3-phenoxypropyl)amino]propan-1-one.
| Compound Name | 1-(1-benzofuran-2-yl)-3-[(2-hydroxy-3-phenoxypropyl)amino]propan-1-one |
|---|---|
| PubChem CID | 110177515 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-3-[(2-hydroxy-3-phenoxypropyl)amino]propan-1-one |
| SMILES | O=C(CCNCC(O)COc1ccccc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H21NO4/c22-16(14-24-17-7-2-1-3-8-17)13-21-11-10-18(23)20-12-15-6-4-5-9-19(15)25-20/h1-9,12,16,21-22H,10-11,13-14H2 |
| InChIKey | GLDQFVDMDPEONU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|