C22H23N3O5 — CID 19079737
1-[2-[[2-(5-methyl-1,2,4-oxadiazol-3-yl)-1-benzofuran-5-yl]oxy]ethylamino]-3-phenoxypropan-2-ol (PubChem CID 19079737) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is 1-[2-[[2-(5-methyl-1,2,4-oxadiazol-3-yl)-1-benzofuran-5-yl]oxy]ethylamino]-3-phenoxypropan-2-ol.
| Compound Name | 1-[2-[[2-(5-methyl-1,2,4-oxadiazol-3-yl)-1-benzofuran-5-yl]oxy]ethylamino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 19079737 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 1-[2-[[2-(5-methyl-1,2,4-oxadiazol-3-yl)-1-benzofuran-5-yl]oxy]ethylamino]-3-phenoxypropan-2-ol |
| SMILES | Cc1nc(-c2cc3cc(OCCNCC(O)COc4ccccc4)ccc3o2)no1 |
| InChI | InChI=1S/C22H23N3O5/c1-15-24-22(25-30-15)21-12-16-11-19(7-8-20(16)29-21)27-10-9-23-13-17(26)14-28-18-5-3-2-4-6-18/h2-8,11-12,17,23,26H,9-10,13-14H2,1H3 |
| InChIKey | QRFOMAIVAYQSRL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|