C20H23N3O3 — CID 14739905
1-[2-(4-imidazol-1-ylphenoxy)ethylamino]-3-phenoxypropan-2-ol (PubChem CID 14739905) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 1-[2-(4-imidazol-1-ylphenoxy)ethylamino]-3-phenoxypropan-2-ol.
| Compound Name | 1-[2-(4-imidazol-1-ylphenoxy)ethylamino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 14739905 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-[2-(4-imidazol-1-ylphenoxy)ethylamino]-3-phenoxypropan-2-ol |
| SMILES | OC(CNCCOc1ccc(-n2ccnc2)cc1)COc1ccccc1 |
| InChI | InChI=1S/C20H23N3O3/c24-18(15-26-19-4-2-1-3-5-19)14-21-11-13-25-20-8-6-17(7-9-20)23-12-10-22-16-23/h1-10,12,16,18,21,24H,11,13-15H2 |
| InChIKey | XMLOXOFMPHIHFN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|