C23H23Cl2N3O4 — CID 22729187
1-[3-(3,4-dichlorophenyl)propylamino]-3-[[2-(5-methyl-1,2,4-oxadiazol-3-yl)-1-benzofuran-4-yl]oxy]propan-2-ol (PubChem CID 22729187) has the molecular formula C23H23Cl2N3O4 and a molecular weight of 476.36 g/mol. Its IUPAC name is 1-[3-(3,4-dichlorophenyl)propylamino]-3-[[2-(5-methyl-1,2,4-oxadiazol-3-yl)-1-benzofuran-4-yl]oxy]propan-2-ol.
| Compound Name | 1-[3-(3,4-dichlorophenyl)propylamino]-3-[[2-(5-methyl-1,2,4-oxadiazol-3-yl)-1-benzofuran-4-yl]oxy]propan-2-ol |
|---|---|
| PubChem CID | 22729187 |
| Molecular Formula | C23H23Cl2N3O4 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | 1-[3-(3,4-dichlorophenyl)propylamino]-3-[[2-(5-methyl-1,2,4-oxadiazol-3-yl)-1-benzofuran-4-yl]oxy]propan-2-ol |
| SMILES | Cc1nc(-c2cc3c(OCC(O)CNCCCc4ccc(Cl)c(Cl)c4)cccc3o2)no1 |
| InChI | InChI=1S/C23H23Cl2N3O4/c1-14-27-23(28-32-14)22-11-17-20(5-2-6-21(17)31-22)30-13-16(29)12-26-9-3-4-15-7-8-18(24)19(25)10-15/h2,5-8,10-11,16,26,29H,3-4,9,12-13H2,1H3 |
| InChIKey | XKFVFJVAUMIWBW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|