C17H18Cl2FNO3 — CID 67249841
4-[(2S)-3-[2-(3,4-dichlorophenyl)ethylamino]-2-hydroxypropoxy]-2-fluorophenol (PubChem CID 67249841) has the molecular formula C17H18Cl2FNO3 and a molecular weight of 374.24 g/mol. Its IUPAC name is 4-[(2S)-3-[2-(3,4-dichlorophenyl)ethylamino]-2-hydroxypropoxy]-2-fluorophenol.
| Compound Name | 4-[(2S)-3-[2-(3,4-dichlorophenyl)ethylamino]-2-hydroxypropoxy]-2-fluorophenol |
|---|---|
| PubChem CID | 67249841 |
| Molecular Formula | C17H18Cl2FNO3 |
| Molecular Weight | 374.24 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 4-[(2S)-3-[2-(3,4-dichlorophenyl)ethylamino]-2-hydroxypropoxy]-2-fluorophenol |
| SMILES | Oc1ccc(OC[C@@H](O)CNCCc2ccc(Cl)c(Cl)c2)cc1F |
| InChI | InChI=1S/C17H18Cl2FNO3/c18-14-3-1-11(7-15(14)19)5-6-21-9-12(22)10-24-13-2-4-17(23)16(20)8-13/h1-4,7-8,12,21-23H,5-6,9-10H2/t12-/m0/s1 |
| InChIKey | RADRGHONZLROLA-LBPRGKRZSA-N |
| XLogP | 3.41 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.24 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|