C11H14Cl2N2O3 — CID 60900938
2-[[3-(3,4-dichlorophenoxy)-2-hydroxypropyl]amino]acetamide (PubChem CID 60900938) has the molecular formula C11H14Cl2N2O3 and a molecular weight of 293.15 g/mol. Its IUPAC name is 2-[[3-(3,4-dichlorophenoxy)-2-hydroxypropyl]amino]acetamide.
| Compound Name | 2-[[3-(3,4-dichlorophenoxy)-2-hydroxypropyl]amino]acetamide |
|---|---|
| PubChem CID | 60900938 |
| Molecular Formula | C11H14Cl2N2O3 |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 2-[[3-(3,4-dichlorophenoxy)-2-hydroxypropyl]amino]acetamide |
| SMILES | NC(=O)CNCC(O)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2O3/c12-9-2-1-8(3-10(9)13)18-6-7(16)4-15-5-11(14)17/h1-3,7,15-16H,4-6H2,(H2,14,17) |
| InChIKey | IFMLLTORCCCVFI-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |