C14H22ClNO2 — CID 60635656
1-(4-chloro-3-methylphenoxy)-3-(2-methylpropylamino)propan-2-ol (PubChem CID 60635656) has the molecular formula C14H22ClNO2 and a molecular weight of 271.79 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenoxy)-3-(2-methylpropylamino)propan-2-ol.
| Compound Name | 1-(4-chloro-3-methylphenoxy)-3-(2-methylpropylamino)propan-2-ol |
|---|---|
| PubChem CID | 60635656 |
| Molecular Formula | C14H22ClNO2 |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 1-(4-chloro-3-methylphenoxy)-3-(2-methylpropylamino)propan-2-ol |
| SMILES | Cc1cc(OCC(O)CNCC(C)C)ccc1Cl |
| InChI | InChI=1S/C14H22ClNO2/c1-10(2)7-16-8-12(17)9-18-13-4-5-14(15)11(3)6-13/h4-6,10,12,16-17H,7-9H2,1-3H3 |
| InChIKey | SOKWZKCIOBEATB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |