C16H20ClNO3 — CID 62523170
1-(4-chloro-3-methylphenoxy)-3-[(5-methylfuran-2-yl)methylamino]propan-2-ol (PubChem CID 62523170) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenoxy)-3-[(5-methylfuran-2-yl)methylamino]propan-2-ol.
| Compound Name | 1-(4-chloro-3-methylphenoxy)-3-[(5-methylfuran-2-yl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 62523170 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-(4-chloro-3-methylphenoxy)-3-[(5-methylfuran-2-yl)methylamino]propan-2-ol |
| SMILES | Cc1ccc(CNCC(O)COc2ccc(Cl)c(C)c2)o1 |
| InChI | InChI=1S/C16H20ClNO3/c1-11-7-14(5-6-16(11)17)20-10-13(19)8-18-9-15-4-3-12(2)21-15/h3-7,13,18-19H,8-10H2,1-2H3 |
| InChIKey | UGDYKTMNAQLYRL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |