C14H22ClNO3 — CID 60633816
1-(4-chloro-3-methylphenoxy)-3-(3-methoxypropylamino)propan-2-ol (PubChem CID 60633816) has the molecular formula C14H22ClNO3 and a molecular weight of 287.79 g/mol. Its IUPAC name is 1-(4-chloro-3-methylphenoxy)-3-(3-methoxypropylamino)propan-2-ol.
| Compound Name | 1-(4-chloro-3-methylphenoxy)-3-(3-methoxypropylamino)propan-2-ol |
|---|---|
| PubChem CID | 60633816 |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-(4-chloro-3-methylphenoxy)-3-(3-methoxypropylamino)propan-2-ol |
| SMILES | COCCCNCC(O)COc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C14H22ClNO3/c1-11-8-13(4-5-14(11)15)19-10-12(17)9-16-6-3-7-18-2/h4-5,8,12,16-17H,3,6-7,9-10H2,1-2H3 |
| InChIKey | UJVWBHJSECUJID-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|