C12H18Cl2N2O2 — CID 62275385
1-(3-aminopropylamino)-3-(3,4-dichlorophenoxy)propan-2-ol (PubChem CID 62275385) has the molecular formula C12H18Cl2N2O2 and a molecular weight of 293.19 g/mol. Its IUPAC name is 1-(3-aminopropylamino)-3-(3,4-dichlorophenoxy)propan-2-ol.
| Compound Name | 1-(3-aminopropylamino)-3-(3,4-dichlorophenoxy)propan-2-ol |
|---|---|
| PubChem CID | 62275385 |
| Molecular Formula | C12H18Cl2N2O2 |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 1-(3-aminopropylamino)-3-(3,4-dichlorophenoxy)propan-2-ol |
| SMILES | NCCCNCC(O)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H18Cl2N2O2/c13-11-3-2-10(6-12(11)14)18-8-9(17)7-16-5-1-4-15/h2-3,6,9,16-17H,1,4-5,7-8,15H2 |
| InChIKey | KAVYXCWIAMGGTN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|