C11H16Cl2N2O — CID 2977619
N'-[2-(3,4-dichlorophenoxy)ethyl]propane-1,3-diamine (PubChem CID 2977619) has the molecular formula C11H16Cl2N2O and a molecular weight of 263.17 g/mol. Its IUPAC name is N'-[2-(3,4-dichlorophenoxy)ethyl]propane-1,3-diamine.
| Compound Name | N'-[2-(3,4-dichlorophenoxy)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 2977619 |
| Molecular Formula | C11H16Cl2N2O |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | N'-[2-(3,4-dichlorophenoxy)ethyl]propane-1,3-diamine |
| SMILES | NCCCNCCOc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H16Cl2N2O/c12-10-3-2-9(8-11(10)13)16-7-6-15-5-1-4-14/h2-3,8,15H,1,4-7,14H2 |
| InChIKey | LSKQRVQOWICCTA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|