C10H11Cl2NO3 — CID 89477736
3-(3,4-dichlorophenoxy)propylcarbamic acid (PubChem CID 89477736) has the molecular formula C10H11Cl2NO3 and a molecular weight of 264.11 g/mol. Its IUPAC name is 3-(3,4-dichlorophenoxy)propylcarbamic acid.
| Compound Name | 3-(3,4-dichlorophenoxy)propylcarbamic acid |
|---|---|
| PubChem CID | 89477736 |
| Molecular Formula | C10H11Cl2NO3 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 3-(3,4-dichlorophenoxy)propylcarbamic acid |
| SMILES | O=C(O)NCCCOc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2NO3/c11-8-3-2-7(6-9(8)12)16-5-1-4-13-10(14)15/h2-3,6,13H,1,4-5H2,(H,14,15) |
| InChIKey | DPVOGRCHLOZOAB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|