C10H13Cl2NO — CID 6457952
2-(3,4-dichlorophenoxy)-N-ethylethanamine (PubChem CID 6457952) has the molecular formula C10H13Cl2NO and a molecular weight of 234.13 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-N-ethylethanamine.
| Compound Name | 2-(3,4-dichlorophenoxy)-N-ethylethanamine |
|---|---|
| PubChem CID | 6457952 |
| Molecular Formula | C10H13Cl2NO |
| Molecular Weight | 234.13 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-N-ethylethanamine |
| SMILES | CCNCCOc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H13Cl2NO/c1-2-13-5-6-14-8-3-4-9(11)10(12)7-8/h3-4,7,13H,2,5-6H2,1H3 |
| InChIKey | RWMNJLIPRDKKJX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.13 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|