C17H16Cl2FNO3 — CID 39490271
2-(3,4-dichlorophenoxy)-N-[3-(2-fluorophenoxy)propyl]acetamide (PubChem CID 39490271) has the molecular formula C17H16Cl2FNO3 and a molecular weight of 372.22 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-N-[3-(2-fluorophenoxy)propyl]acetamide.
| Compound Name | 2-(3,4-dichlorophenoxy)-N-[3-(2-fluorophenoxy)propyl]acetamide |
|---|---|
| PubChem CID | 39490271 |
| Molecular Formula | C17H16Cl2FNO3 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-N-[3-(2-fluorophenoxy)propyl]acetamide |
| SMILES | O=C(COc1ccc(Cl)c(Cl)c1)NCCCOc1ccccc1F |
| InChI | InChI=1S/C17H16Cl2FNO3/c18-13-7-6-12(10-14(13)19)24-11-17(22)21-8-3-9-23-16-5-2-1-4-15(16)20/h1-2,4-7,10H,3,8-9,11H2,(H,21,22) |
| InChIKey | SCSZRVCTYYOJIP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|