C19H22FNO4 — CID 18120320
N-[3-(2-fluorophenoxy)propyl]-2-(2-methoxy-4-methylphenoxy)acetamide (PubChem CID 18120320) has the molecular formula C19H22FNO4 and a molecular weight of 347.39 g/mol. Its IUPAC name is N-[3-(2-fluorophenoxy)propyl]-2-(2-methoxy-4-methylphenoxy)acetamide.
| Compound Name | N-[3-(2-fluorophenoxy)propyl]-2-(2-methoxy-4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 18120320 |
| Molecular Formula | C19H22FNO4 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[3-(2-fluorophenoxy)propyl]-2-(2-methoxy-4-methylphenoxy)acetamide |
| SMILES | COc1cc(C)ccc1OCC(=O)NCCCOc1ccccc1F |
| InChI | InChI=1S/C19H22FNO4/c1-14-8-9-17(18(12-14)23-2)25-13-19(22)21-10-5-11-24-16-7-4-3-6-15(16)20/h3-4,6-9,12H,5,10-11,13H2,1-2H3,(H,21,22) |
| InChIKey | SGPZEMQMWNCRTJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|