C17H17Cl2NO4 — CID 26268404
2-(2,4-dichlorophenoxy)-N-[2-(2-methoxyphenoxy)ethyl]acetamide (PubChem CID 26268404) has the molecular formula C17H17Cl2NO4 and a molecular weight of 370.23 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[2-(2-methoxyphenoxy)ethyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[2-(2-methoxyphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 26268404 |
| Molecular Formula | C17H17Cl2NO4 |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[2-(2-methoxyphenoxy)ethyl]acetamide |
| SMILES | COc1ccccc1OCCNC(=O)COc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H17Cl2NO4/c1-22-15-4-2-3-5-16(15)23-9-8-20-17(21)11-24-14-7-6-12(18)10-13(14)19/h2-7,10H,8-9,11H2,1H3,(H,20,21) |
| InChIKey | YRXPGHIWJVOJKY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|