C20H18FNO5 — CID 7927599
N-[2-(2-fluorophenoxy)ethyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide (PubChem CID 7927599) has the molecular formula C20H18FNO5 and a molecular weight of 371.36 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)ethyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[2-(2-fluorophenoxy)ethyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 7927599 |
| Molecular Formula | C20H18FNO5 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | N-[2-(2-fluorophenoxy)ethyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)NCCOc3ccccc3F)ccc12 |
| InChI | InChI=1S/C20H18FNO5/c1-13-10-20(24)27-18-11-14(6-7-15(13)18)26-12-19(23)22-8-9-25-17-5-3-2-4-16(17)21/h2-7,10-11H,8-9,12H2,1H3,(H,22,23) |
| InChIKey | YKCHNNPYNDJEAF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|