C11H12Cl2N2O4 — CID 175188468
2-[[2-(3,4-dichlorophenoxy)acetyl]amino]ethyl carbamate (PubChem CID 175188468) has the molecular formula C11H12Cl2N2O4 and a molecular weight of 307.13 g/mol. Its IUPAC name is 2-[[2-(3,4-dichlorophenoxy)acetyl]amino]ethyl carbamate.
| Compound Name | 2-[[2-(3,4-dichlorophenoxy)acetyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 175188468 |
| Molecular Formula | C11H12Cl2N2O4 |
| Molecular Weight | 307.13 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 2-[[2-(3,4-dichlorophenoxy)acetyl]amino]ethyl carbamate |
| SMILES | NC(=O)OCCNC(=O)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2N2O4/c12-8-2-1-7(5-9(8)13)19-6-10(16)15-3-4-18-11(14)17/h1-2,5H,3-4,6H2,(H2,14,17)(H,15,16) |
| InChIKey | OKCHNZUWFHZVNP-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.13 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|