C12H16Cl2N2O4 — CID 83209571
2-[[3-(3,4-dichlorophenoxy)-2-hydroxypropyl]amino]ethyl carbamate (PubChem CID 83209571) has the molecular formula C12H16Cl2N2O4 and a molecular weight of 323.18 g/mol. Its IUPAC name is 2-[[3-(3,4-dichlorophenoxy)-2-hydroxypropyl]amino]ethyl carbamate.
| Compound Name | 2-[[3-(3,4-dichlorophenoxy)-2-hydroxypropyl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 83209571 |
| Molecular Formula | C12H16Cl2N2O4 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 2-[[3-(3,4-dichlorophenoxy)-2-hydroxypropyl]amino]ethyl carbamate |
| SMILES | NC(=O)OCCNCC(O)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H16Cl2N2O4/c13-10-2-1-9(5-11(10)14)20-7-8(17)6-16-3-4-19-12(15)18/h1-2,5,8,16-17H,3-4,6-7H2,(H2,15,18) |
| InChIKey | ZEDNZUCKCRYBJZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|