C12H13Cl2F4NO2 — CID 106291336
1-(3,4-dichlorophenoxy)-3-(2,2,3,3-tetrafluoropropylamino)propan-2-ol (PubChem CID 106291336) has the molecular formula C12H13Cl2F4NO2 and a molecular weight of 350.14 g/mol. Its IUPAC name is 1-(3,4-dichlorophenoxy)-3-(2,2,3,3-tetrafluoropropylamino)propan-2-ol.
| Compound Name | 1-(3,4-dichlorophenoxy)-3-(2,2,3,3-tetrafluoropropylamino)propan-2-ol |
|---|---|
| PubChem CID | 106291336 |
| Molecular Formula | C12H13Cl2F4NO2 |
| Molecular Weight | 350.14 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 1-(3,4-dichlorophenoxy)-3-(2,2,3,3-tetrafluoropropylamino)propan-2-ol |
| SMILES | OC(CNCC(F)(F)C(F)F)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H13Cl2F4NO2/c13-9-2-1-8(3-10(9)14)21-5-7(20)4-19-6-12(17,18)11(15)16/h1-3,7,11,19-20H,4-6H2 |
| InChIKey | RVYBLWIHNVQMQX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.14 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|