C11H12Cl2F3NO3 — CID 82721381
1-(3,4-dichlorophenoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol (PubChem CID 82721381) has the molecular formula C11H12Cl2F3NO3 and a molecular weight of 334.12 g/mol. Its IUPAC name is 1-(3,4-dichlorophenoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol.
| Compound Name | 1-(3,4-dichlorophenoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol |
|---|---|
| PubChem CID | 82721381 |
| Molecular Formula | C11H12Cl2F3NO3 |
| Molecular Weight | 334.12 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 1-(3,4-dichlorophenoxy)-3-(2,2,2-trifluoroethoxyamino)propan-2-ol |
| SMILES | OC(CNOCC(F)(F)F)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2F3NO3/c12-9-2-1-8(3-10(9)13)19-5-7(18)4-17-20-6-11(14,15)16/h1-3,7,17-18H,4-6H2 |
| InChIKey | APASMBQXGHSJTM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.12 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|