C12H15ClF3NO3 — CID 82721875
1-[(4-chlorophenyl)methoxy]-3-(2,2,2-trifluoroethoxyamino)propan-2-ol (PubChem CID 82721875) has the molecular formula C12H15ClF3NO3 and a molecular weight of 313.70 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methoxy]-3-(2,2,2-trifluoroethoxyamino)propan-2-ol.
| Compound Name | 1-[(4-chlorophenyl)methoxy]-3-(2,2,2-trifluoroethoxyamino)propan-2-ol |
|---|---|
| PubChem CID | 82721875 |
| Molecular Formula | C12H15ClF3NO3 |
| Molecular Weight | 313.70 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 1-[(4-chlorophenyl)methoxy]-3-(2,2,2-trifluoroethoxyamino)propan-2-ol |
| SMILES | OC(CNOCC(F)(F)F)COCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15ClF3NO3/c13-10-3-1-9(2-4-10)6-19-7-11(18)5-17-20-8-12(14,15)16/h1-4,11,17-18H,5-8H2 |
| InChIKey | GMNPRXHVHDRQBH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.70 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|