C14H22Cl2NO2- — CID 53313843
1-(butan-2-ylamino)-3-[(4-chlorophenyl)methoxy]propan-2-ol chloride (PubChem CID 53313843) has the molecular formula C14H22Cl2NO2- and a molecular weight of 307.24 g/mol. Its IUPAC name is 1-(butan-2-ylamino)-3-[(4-chlorophenyl)methoxy]propan-2-ol chloride.
| Compound Name | 1-(butan-2-ylamino)-3-[(4-chlorophenyl)methoxy]propan-2-ol chloride |
|---|---|
| PubChem CID | 53313843 |
| Molecular Formula | C14H22Cl2NO2- |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-(butan-2-ylamino)-3-[(4-chlorophenyl)methoxy]propan-2-ol chloride |
| SMILES | CCC(C)NCC(O)COCc1ccc(Cl)cc1.[Cl-] |
| InChI | InChI=1S/C14H22ClNO2.ClH/c1-3-11(2)16-8-14(17)10-18-9-12-4-6-13(15)7-5-12;/h4-7,11,14,16-17H,3,8-10H2,1-2H3;1H/p-1 |
| InChIKey | ONFWALCGDAXDFL-UHFFFAOYSA-M |
| XLogP | -0.39 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |