C13H19ClN2O4 — CID 106174960
3-[[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]amino]-2-hydroxypropanamide (PubChem CID 106174960) has the molecular formula C13H19ClN2O4 and a molecular weight of 302.76 g/mol. Its IUPAC name is 3-[[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]amino]-2-hydroxypropanamide.
| Compound Name | 3-[[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106174960 |
| Molecular Formula | C13H19ClN2O4 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 3-[[3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]amino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNCC(O)COCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H19ClN2O4/c14-10-3-1-9(2-4-10)7-20-8-11(17)5-16-6-12(18)13(15)19/h1-4,11-12,16-18H,5-8H2,(H2,15,19) |
| InChIKey | ULMSXSZVKPHOBA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |