C18H23ClN2O4S — CID 39915403
4-[2-[[(2S)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]amino]ethyl]benzenesulfonamide (PubChem CID 39915403) has the molecular formula C18H23ClN2O4S and a molecular weight of 398.91 g/mol. Its IUPAC name is 4-[2-[[(2S)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[(2S)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 39915403 |
| Molecular Formula | C18H23ClN2O4S |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 4-[2-[[(2S)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]amino]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNC[C@H](O)COCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H23ClN2O4S/c19-16-5-1-15(2-6-16)12-25-13-17(22)11-21-10-9-14-3-7-18(8-4-14)26(20,23)24/h1-8,17,21-22H,9-13H2,(H2,20,23,24)/t17-/m0/s1 |
| InChIKey | SVLAGWWVCDUZBS-KRWDZBQOSA-N |
| XLogP | 1.70 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|