C8H18N2O4 — CID 106174560
3-[(3-ethoxy-2-hydroxypropyl)amino]-2-hydroxypropanamide (PubChem CID 106174560) has the molecular formula C8H18N2O4 and a molecular weight of 206.24 g/mol. Its IUPAC name is 3-[(3-ethoxy-2-hydroxypropyl)amino]-2-hydroxypropanamide.
| Compound Name | 3-[(3-ethoxy-2-hydroxypropyl)amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106174560 |
| Molecular Formula | C8H18N2O4 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 3-[(3-ethoxy-2-hydroxypropyl)amino]-2-hydroxypropanamide |
| SMILES | CCOCC(O)CNCC(O)C(N)=O |
| InChI | InChI=1S/C8H18N2O4/c1-2-14-5-6(11)3-10-4-7(12)8(9)13/h6-7,10-12H,2-5H2,1H3,(H2,9,13) |
| InChIKey | JHCZNXPJZTXLKM-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |