C7H16N2O4 — CID 106170441
3-(2,2-dimethoxyethylamino)-2-hydroxypropanamide (PubChem CID 106170441) has the molecular formula C7H16N2O4 and a molecular weight of 192.22 g/mol. Its IUPAC name is 3-(2,2-dimethoxyethylamino)-2-hydroxypropanamide.
| Compound Name | 3-(2,2-dimethoxyethylamino)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106170441 |
| Molecular Formula | C7H16N2O4 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 3-(2,2-dimethoxyethylamino)-2-hydroxypropanamide |
| SMILES | COC(CNCC(O)C(N)=O)OC |
| InChI | InChI=1S/C7H16N2O4/c1-12-6(13-2)4-9-3-5(10)7(8)11/h5-6,9-10H,3-4H2,1-2H3,(H2,8,11) |
| InChIKey | CTPRFFJQFZISFU-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|