C7H17NO4 — CID 60650308
3-(2,2-dimethoxyethylamino)propane-1,2-diol (PubChem CID 60650308) has the molecular formula C7H17NO4 and a molecular weight of 179.22 g/mol. Its IUPAC name is 3-(2,2-dimethoxyethylamino)propane-1,2-diol.
| Compound Name | 3-(2,2-dimethoxyethylamino)propane-1,2-diol |
|---|---|
| PubChem CID | 60650308 |
| Molecular Formula | C7H17NO4 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | 3-(2,2-dimethoxyethylamino)propane-1,2-diol |
| SMILES | COC(CNCC(O)CO)OC |
| InChI | InChI=1S/C7H17NO4/c1-11-7(12-2)4-8-3-6(10)5-9/h6-10H,3-5H2,1-2H3 |
| InChIKey | HGYZEWLDQZPZFT-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|