C13H21NO4 — CID 2421328
(2R)-1-(2,2-dimethoxyethylamino)-3-phenoxypropan-2-ol (PubChem CID 2421328) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is (2R)-1-(2,2-dimethoxyethylamino)-3-phenoxypropan-2-ol.
| Compound Name | (2R)-1-(2,2-dimethoxyethylamino)-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 2421328 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | (2R)-1-(2,2-dimethoxyethylamino)-3-phenoxypropan-2-ol |
| SMILES | COC(CNC[C@@H](O)COc1ccccc1)OC |
| InChI | InChI=1S/C13H21NO4/c1-16-13(17-2)9-14-8-11(15)10-18-12-6-4-3-5-7-12/h3-7,11,13-15H,8-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | ZLQKWLXPAJVODN-LLVKDONJSA-N |
| XLogP | 0.63 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|