C12H20N2O2 — CID 54410968
1-(2-aminopropylamino)-3-phenoxypropan-2-ol (PubChem CID 54410968) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-(2-aminopropylamino)-3-phenoxypropan-2-ol.
| Compound Name | 1-(2-aminopropylamino)-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 54410968 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 1-(2-aminopropylamino)-3-phenoxypropan-2-ol |
| SMILES | CC(N)CNCC(O)COc1ccccc1 |
| InChI | InChI=1S/C12H20N2O2/c1-10(13)7-14-8-11(15)9-16-12-5-3-2-4-6-12/h2-6,10-11,14-15H,7-9,13H2,1H3 |
| InChIKey | VUCRWUDBPTWIFE-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |