C21H30N2O2 — CID 70462176
(2R)-1-[[(2R)-1-[4-[(2R)-2-aminopropyl]phenyl]propan-2-yl]amino]-3-phenoxypropan-2-ol (PubChem CID 70462176) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is (2R)-1-[[(2R)-1-[4-[(2R)-2-aminopropyl]phenyl]propan-2-yl]amino]-3-phenoxypropan-2-ol.
| Compound Name | (2R)-1-[[(2R)-1-[4-[(2R)-2-aminopropyl]phenyl]propan-2-yl]amino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 70462176 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | (2R)-1-[[(2R)-1-[4-[(2R)-2-aminopropyl]phenyl]propan-2-yl]amino]-3-phenoxypropan-2-ol |
| SMILES | C[C@H](Cc1ccc(C[C@@H](C)N)cc1)NC[C@@H](O)COc1ccccc1 |
| InChI | InChI=1S/C21H30N2O2/c1-16(22)12-18-8-10-19(11-9-18)13-17(2)23-14-20(24)15-25-21-6-4-3-5-7-21/h3-11,16-17,20,23-24H,12-15,22H2,1-2H3/t16-,17-,20-/m1/s1 |
| InChIKey | QRYFDNFGIGCTST-MBOZVWFJSA-N |
| XLogP | 2.54 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |