C24H28N2O5S — CID 19384973
N-[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]propyl]phenyl]benzenesulfonamide (PubChem CID 19384973) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is N-[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]propyl]phenyl]benzenesulfonamide.
| Compound Name | N-[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]propyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19384973 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]propyl]phenyl]benzenesulfonamide |
| SMILES | CC(Cc1ccc(NS(=O)(=O)c2ccccc2)cc1)NCC(O)COc1ccc(O)cc1 |
| InChI | InChI=1S/C24H28N2O5S/c1-18(25-16-22(28)17-31-23-13-11-21(27)12-14-23)15-19-7-9-20(10-8-19)26-32(29,30)24-5-3-2-4-6-24/h2-14,18,22,25-28H,15-17H2,1H3 |
| InChIKey | DNVROWQPFFZNSV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |