C27H34N2O5S — CID 59879605
4-tert-butyl-N-[4-[2-[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenyl]benzenesulfonamide (PubChem CID 59879605) has the molecular formula C27H34N2O5S and a molecular weight of 498.65 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[2-[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenyl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[4-[2-[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59879605 |
| Molecular Formula | C27H34N2O5S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 4-tert-butyl-N-[4-[2-[[(2S)-2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]ethyl]phenyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(CCNC[C@H](O)COc3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H34N2O5S/c1-27(2,3)21-6-14-26(15-7-21)35(32,33)29-22-8-4-20(5-9-22)16-17-28-18-24(31)19-34-25-12-10-23(30)11-13-25/h4-15,24,28-31H,16-19H2,1-3H3/t24-/m0/s1 |
| InChIKey | JGWALDDYHKCTBO-DEOSSOPVSA-N |
| XLogP | 4.06 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|