C18H24N2O6S — CID 25107956
N-[4-[(2S)-3-[2-(3,5-dihydroxyphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide (PubChem CID 25107956) has the molecular formula C18H24N2O6S and a molecular weight of 396.47 g/mol. Its IUPAC name is N-[4-[(2S)-3-[2-(3,5-dihydroxyphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(2S)-3-[2-(3,5-dihydroxyphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 25107956 |
| Molecular Formula | C18H24N2O6S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N-[4-[(2S)-3-[2-(3,5-dihydroxyphenyl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(OC[C@@H](O)CNCCc2cc(O)cc(O)c2)cc1 |
| InChI | InChI=1S/C18H24N2O6S/c1-27(24,25)20-14-2-4-18(5-3-14)26-12-17(23)11-19-7-6-13-8-15(21)10-16(22)9-13/h2-5,8-10,17,19-23H,6-7,11-12H2,1H3/t17-/m0/s1 |
| InChIKey | RDWCGJFJFNMTCA-KRWDZBQOSA-N |
| XLogP | 1.04 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|