C18H24N2O4S — CID 14739889
N-[4-[[[2-hydroxy-3-(3-methylphenoxy)propyl]amino]methyl]phenyl]methanesulfonamide (PubChem CID 14739889) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-[4-[[[2-hydroxy-3-(3-methylphenoxy)propyl]amino]methyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[[[2-hydroxy-3-(3-methylphenoxy)propyl]amino]methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 14739889 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-[4-[[[2-hydroxy-3-(3-methylphenoxy)propyl]amino]methyl]phenyl]methanesulfonamide |
| SMILES | Cc1cccc(OCC(O)CNCc2ccc(NS(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C18H24N2O4S/c1-14-4-3-5-18(10-14)24-13-17(21)12-19-11-15-6-8-16(9-7-15)20-25(2,22)23/h3-10,17,19-21H,11-13H2,1-2H3 |
| InChIKey | PCRICIUMMKDSIF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |