C21H25ClFN3O4S — CID 19913049
N-[4-[3-[2-(6-fluoroquinolin-2-yl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide;hydrochloride (PubChem CID 19913049) has the molecular formula C21H25ClFN3O4S and a molecular weight of 469.97 g/mol. Its IUPAC name is N-[4-[3-[2-(6-fluoroquinolin-2-yl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide;hydrochloride.
| Compound Name | N-[4-[3-[2-(6-fluoroquinolin-2-yl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 19913049 |
| Molecular Formula | C21H25ClFN3O4S |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | N-[4-[3-[2-(6-fluoroquinolin-2-yl)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide;hydrochloride |
| SMILES | CS(=O)(=O)Nc1ccc(OCC(O)CNCCc2ccc3cc(F)ccc3n2)cc1.Cl |
| InChI | InChI=1S/C21H24FN3O4S.ClH/c1-30(27,28)25-18-5-7-20(8-6-18)29-14-19(26)13-23-11-10-17-4-2-15-12-16(22)3-9-21(15)24-17;/h2-9,12,19,23,25-26H,10-11,13-14H2,1H3;1H |
| InChIKey | FFTDWSVYHYUCPD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|