C25H25Cl2F3N2O4S — CID 68957428
N-[4-[(2S)-3-[[2-(3,4-dichlorophenyl)-3-(2,3,4-trifluorophenyl)propyl]amino]-2-hydroxypropoxy]phenyl]methanesulfonamide (PubChem CID 68957428) has the molecular formula C25H25Cl2F3N2O4S and a molecular weight of 577.45 g/mol. Its IUPAC name is N-[4-[(2S)-3-[[2-(3,4-dichlorophenyl)-3-(2,3,4-trifluorophenyl)propyl]amino]-2-hydroxypropoxy]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(2S)-3-[[2-(3,4-dichlorophenyl)-3-(2,3,4-trifluorophenyl)propyl]amino]-2-hydroxypropoxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 68957428 |
| Molecular Formula | C25H25Cl2F3N2O4S |
| Molecular Weight | 577.45 g/mol |
| Exact Mass | 576.09 |
| IUPAC Name | N-[4-[(2S)-3-[[2-(3,4-dichlorophenyl)-3-(2,3,4-trifluorophenyl)propyl]amino]-2-hydroxypropoxy]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(OC[C@@H](O)CNCC(Cc2ccc(F)c(F)c2F)c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C25H25Cl2F3N2O4S/c1-37(34,35)32-18-4-6-20(7-5-18)36-14-19(33)13-31-12-17(15-2-8-21(26)22(27)11-15)10-16-3-9-23(28)25(30)24(16)29/h2-9,11,17,19,31-33H,10,12-14H2,1H3/t17?,19-/m0/s1 |
| InChIKey | RQANXJCZYCDWML-NNBQYGFHSA-N |
| XLogP | 5.14 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|