C19H25N3O6S — CID 110169427
4-[2-[[2-hydroxy-3-[4-(methanesulfonamido)phenoxy]propyl]amino]ethoxy]benzamide (PubChem CID 110169427) has the molecular formula C19H25N3O6S and a molecular weight of 423.49 g/mol. Its IUPAC name is 4-[2-[[2-hydroxy-3-[4-(methanesulfonamido)phenoxy]propyl]amino]ethoxy]benzamide.
| Compound Name | 4-[2-[[2-hydroxy-3-[4-(methanesulfonamido)phenoxy]propyl]amino]ethoxy]benzamide |
|---|---|
| PubChem CID | 110169427 |
| Molecular Formula | C19H25N3O6S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 4-[2-[[2-hydroxy-3-[4-(methanesulfonamido)phenoxy]propyl]amino]ethoxy]benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(OCC(O)CNCCOc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C19H25N3O6S/c1-29(25,26)22-15-4-8-18(9-5-15)28-13-16(23)12-21-10-11-27-17-6-2-14(3-7-17)19(20)24/h2-9,16,21-23H,10-13H2,1H3,(H2,20,24) |
| InChIKey | QTFOAOCNQJXGKS-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|