C18H22ClNO5S — CID 22766037
1-[2-(4-chlorophenoxy)ethylamino]-3-(4-methylsulfonylphenoxy)propan-2-ol (PubChem CID 22766037) has the molecular formula C18H22ClNO5S and a molecular weight of 399.90 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)ethylamino]-3-(4-methylsulfonylphenoxy)propan-2-ol.
| Compound Name | 1-[2-(4-chlorophenoxy)ethylamino]-3-(4-methylsulfonylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 22766037 |
| Molecular Formula | C18H22ClNO5S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)ethylamino]-3-(4-methylsulfonylphenoxy)propan-2-ol |
| SMILES | CS(=O)(=O)c1ccc(OCC(O)CNCCOc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H22ClNO5S/c1-26(22,23)18-8-6-17(7-9-18)25-13-15(21)12-20-10-11-24-16-4-2-14(19)3-5-16/h2-9,15,20-21H,10-13H2,1H3 |
| InChIKey | IRDZGMLLHFISNO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|