C19H25NO6S — CID 70614360
4-[2-[[2-hydroxy-3-(5-methyl-2-methylsulfonylphenoxy)propyl]amino]ethoxy]phenol (PubChem CID 70614360) has the molecular formula C19H25NO6S and a molecular weight of 395.48 g/mol. Its IUPAC name is 4-[2-[[2-hydroxy-3-(5-methyl-2-methylsulfonylphenoxy)propyl]amino]ethoxy]phenol.
| Compound Name | 4-[2-[[2-hydroxy-3-(5-methyl-2-methylsulfonylphenoxy)propyl]amino]ethoxy]phenol |
|---|---|
| PubChem CID | 70614360 |
| Molecular Formula | C19H25NO6S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 4-[2-[[2-hydroxy-3-(5-methyl-2-methylsulfonylphenoxy)propyl]amino]ethoxy]phenol |
| SMILES | Cc1ccc(S(C)(=O)=O)c(OCC(O)CNCCOc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C19H25NO6S/c1-14-3-8-19(27(2,23)24)18(11-14)26-13-16(22)12-20-9-10-25-17-6-4-15(21)5-7-17/h3-8,11,16,20-22H,9-10,12-13H2,1-2H3 |
| InChIKey | SSVGYLFVZNJIOD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|