C14H24ClNO4S — CID 70614510
1-(5-methyl-2-methylsulfonylphenoxy)-3-(propan-2-ylamino)propan-2-ol;hydrochloride (PubChem CID 70614510) has the molecular formula C14H24ClNO4S and a molecular weight of 337.87 g/mol. Its IUPAC name is 1-(5-methyl-2-methylsulfonylphenoxy)-3-(propan-2-ylamino)propan-2-ol;hydrochloride.
| Compound Name | 1-(5-methyl-2-methylsulfonylphenoxy)-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 70614510 |
| Molecular Formula | C14H24ClNO4S |
| Molecular Weight | 337.87 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 1-(5-methyl-2-methylsulfonylphenoxy)-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| SMILES | Cc1ccc(S(C)(=O)=O)c(OCC(O)CNC(C)C)c1.Cl |
| InChI | InChI=1S/C14H23NO4S.ClH/c1-10(2)15-8-12(16)9-19-13-7-11(3)5-6-14(13)20(4,17)18;/h5-7,10,12,15-16H,8-9H2,1-4H3;1H |
| InChIKey | NCNBIKGGTLJPCI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.87 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |