C17H30ClNO2 — CID 22419817
1-(2-tert-butyl-4-methylphenoxy)-3-(propan-2-ylamino)propan-2-ol;hydrochloride (PubChem CID 22419817) has the molecular formula C17H30ClNO2 and a molecular weight of 315.89 g/mol. Its IUPAC name is 1-(2-tert-butyl-4-methylphenoxy)-3-(propan-2-ylamino)propan-2-ol;hydrochloride.
| Compound Name | 1-(2-tert-butyl-4-methylphenoxy)-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 22419817 |
| Molecular Formula | C17H30ClNO2 |
| Molecular Weight | 315.89 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 1-(2-tert-butyl-4-methylphenoxy)-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| SMILES | Cc1ccc(OCC(O)CNC(C)C)c(C(C)(C)C)c1.Cl |
| InChI | InChI=1S/C17H29NO2.ClH/c1-12(2)18-10-14(19)11-20-16-8-7-13(3)9-15(16)17(4,5)6;/h7-9,12,14,18-19H,10-11H2,1-6H3;1H |
| InChIKey | SQZVCGJXJZLMHH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.89 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |