C13H22ClNO2 — CID 16812220
1-(4-methylphenoxy)-3-(propan-2-ylamino)propan-2-ol;hydrochloride (PubChem CID 16812220) has the molecular formula C13H22ClNO2 and a molecular weight of 259.78 g/mol. Its IUPAC name is 1-(4-methylphenoxy)-3-(propan-2-ylamino)propan-2-ol;hydrochloride.
| Compound Name | 1-(4-methylphenoxy)-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 16812220 |
| Molecular Formula | C13H22ClNO2 |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 1-(4-methylphenoxy)-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| SMILES | Cc1ccc(OCC(O)CNC(C)C)cc1.Cl |
| InChI | InChI=1S/C13H21NO2.ClH/c1-10(2)14-8-12(15)9-16-13-6-4-11(3)5-7-13;/h4-7,10,12,14-15H,8-9H2,1-3H3;1H |
| InChIKey | JPHPNUCUQDXFHJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |