C14H26N2O3 — CID 70528605
1-(4-aminophenoxy)-3-(propan-2-ylamino)propan-2-ol;ethanol (PubChem CID 70528605) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-(4-aminophenoxy)-3-(propan-2-ylamino)propan-2-ol;ethanol.
| Compound Name | 1-(4-aminophenoxy)-3-(propan-2-ylamino)propan-2-ol;ethanol |
|---|---|
| PubChem CID | 70528605 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 1-(4-aminophenoxy)-3-(propan-2-ylamino)propan-2-ol;ethanol |
| SMILES | CC(C)NCC(O)COc1ccc(N)cc1.CCO |
| InChI | InChI=1S/C12H20N2O2.C2H6O/c1-9(2)14-7-11(15)8-16-12-5-3-10(13)4-6-12;1-2-3/h3-6,9,11,14-15H,7-8,13H2,1-2H3;3H,2H2,1H3 |
| InChIKey | YKKQLPZFWQPZAU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|