C18H31NO4 — CID 177126524
1-(propan-2-ylamino)-3-[4-(3-propan-2-yloxypropoxy)phenoxy]propan-2-ol (PubChem CID 177126524) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is 1-(propan-2-ylamino)-3-[4-(3-propan-2-yloxypropoxy)phenoxy]propan-2-ol.
| Compound Name | 1-(propan-2-ylamino)-3-[4-(3-propan-2-yloxypropoxy)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 177126524 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | 1-(propan-2-ylamino)-3-[4-(3-propan-2-yloxypropoxy)phenoxy]propan-2-ol |
| SMILES | CC(C)NCC(O)COc1ccc(OCCCOC(C)C)cc1 |
| InChI | InChI=1S/C18H31NO4/c1-14(2)19-12-16(20)13-23-18-8-6-17(7-9-18)22-11-5-10-21-15(3)4/h6-9,14-16,19-20H,5,10-13H2,1-4H3 |
| InChIKey | BBBNGQGRSGSJHQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|