C13H26Cl3N3O2 — CID 70531936
1-(2,3-diamino-5-methylphenoxy)-3-(propan-2-ylamino)propan-2-ol;trihydrochloride (PubChem CID 70531936) has the molecular formula C13H26Cl3N3O2 and a molecular weight of 362.73 g/mol. Its IUPAC name is 1-(2,3-diamino-5-methylphenoxy)-3-(propan-2-ylamino)propan-2-ol;trihydrochloride.
| Compound Name | 1-(2,3-diamino-5-methylphenoxy)-3-(propan-2-ylamino)propan-2-ol;trihydrochloride |
|---|---|
| PubChem CID | 70531936 |
| Molecular Formula | C13H26Cl3N3O2 |
| Molecular Weight | 362.73 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-(2,3-diamino-5-methylphenoxy)-3-(propan-2-ylamino)propan-2-ol;trihydrochloride |
| SMILES | Cc1cc(N)c(N)c(OCC(O)CNC(C)C)c1.Cl.Cl.Cl |
| InChI | InChI=1S/C13H23N3O2.3ClH/c1-8(2)16-6-10(17)7-18-12-5-9(3)4-11(14)13(12)15;;;/h4-5,8,10,16-17H,6-7,14-15H2,1-3H3;3*1H |
| InChIKey | SGPUXGQLMIIIBQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.73 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|